|
|
| | Oestradiol 17-heptanoate Basic information |
| Product Name: | Oestradiol 17-heptanoate | | Synonyms: | oestradiol 17-heptanoate;estra-1,3,5(10)-triene-3,17b-diol 17-heptanoate;BETA-ESTRADIOL-17-ENANTHATE;B-estradiol 17-enanthate;estra-1,3,5(10)-triene-3,17beta-diol 17-heptanoate;ESTRADIOL ENANTHATE, MM(CRM STANDARD);1,3,5(10)-Estratreine-3,17β-diol 17-enanthate, 3,17β-Dihydroxy-1,3,5(10)-estratriene 17-enanthate, Estradiol 17-heptanoate;1,3,5(10)-ESTRATRIEN-3,17BETA-DIOL 17-ENANTHATE | | CAS: | 4956-37-0 | | MF: | C25H36O3 | | MW: | 384.56 | | EINECS: | 225-599-8 | | Product Categories: | Hormone Drugs;API;progestogen estrogen;Steroids;APIs | | Mol File: | 4956-37-0.mol |  |
| | Oestradiol 17-heptanoate Chemical Properties |
| Melting point | 94-96° | | Boiling point | 509.5±50.0 °C(Predicted) | | density | 1.11±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 10.25±0.60(Predicted) | | color | White to Off-White | | λmax | 286nm(EtOH)(lit.) | | Merck | 14,3703 | | InChIKey | RFWTZQAOOLFXAY-MTBKBWMONA-N | | SMILES | C[C@]12CC[C@]3([H])C4C=CC(O)=CC=4CC[C@@]3([H])[C@]1([H])CC[C@@H]2OC(=O)CCCCCC |&1:1,4,15,17,21,r| | | CAS DataBase Reference | 4956-37-0(CAS DataBase Reference) |
| | Oestradiol 17-heptanoate Usage And Synthesis |
| Uses | Estradiol Enanthate has been used as an injectable contraceptive. | | Uses | Estrogen. | | Definition | ChEBI: Estradiol enanthate is a steroid ester. |
| | Oestradiol 17-heptanoate Preparation Products And Raw materials |
|