|
| 4-Difluoromethoxy-3-hydroxybenzaldehyde Basic information |
| 4-Difluoromethoxy-3-hydroxybenzaldehyde Chemical Properties |
Melting point | 85-90°C | Boiling point | 280.6±35.0 °C(Predicted) | density | 1.395±0.06 g/cm3(Predicted) | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | solubility | Chloroform (Slightly), Methanol (Slightly) | form | Solid | pka | 7.85±0.35(Predicted) | color | White | InChI | InChI=1S/C8H6F2O3/c9-8(10)13-7-2-1-5(4-11)3-6(7)12/h1-4,8,12H | InChIKey | ZLIKNROJGXXNJG-UHFFFAOYSA-N | SMILES | C(=O)C1=CC=C(OC(F)F)C(O)=C1 | CAS DataBase Reference | 151103-08-1(CAS DataBase Reference) |
| 4-Difluoromethoxy-3-hydroxybenzaldehyde Usage And Synthesis |
Chemical Properties | 4-Difluoromethoxy-3-hydroxybenzaldehyde is white powder | Uses | 4-Difluoromethoxy-3-hydroxybenzaldehyde is a phenyl alkyl ketone derivative used in the preparation of phosphodiesterase-4 (PDE4) inhibitors. |
| 4-Difluoromethoxy-3-hydroxybenzaldehyde Preparation Products And Raw materials |
|