- 4-Fluorophenethylamine
-
- $0.00 / 1KG
-
2022-02-09
- CAS:1583-88-6
- Min. Order: 1KG
- Purity: 98.6%
- Supply Ability: 100 tons
|
| | 4-Fluorophenethylamine Basic information |
| | 4-Fluorophenethylamine Chemical Properties |
| Boiling point | 50-52 °C/0.15 mmHg (lit.) | | density | 1.061 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.5072(lit.) | | Fp | 174 °F | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | pka | 9.84±0.10(Predicted) | | form | Liquid | | Specific Gravity | 1.061 | | color | Yellow | | Water Solubility | Slightly soluble in water. | | InChI | InChI=1S/C8H10FN/c9-8-3-1-7(2-4-8)5-6-10/h1-4H,5-6,10H2 | | InChIKey | CKLFJWXRWIQYOC-UHFFFAOYSA-N | | SMILES | C1(CCN)=CC=C(F)C=C1 | | CAS DataBase Reference | 1583-88-6(CAS DataBase Reference) |
| Hazard Codes | T,C | | Risk Statements | 23/24/25-34 | | Safety Statements | 26-27-36/37/39-45 | | RIDADR | UN 2922 8/PG 2 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | Ⅱ | | HS Code | 29214200 |
| | 4-Fluorophenethylamine Usage And Synthesis |
| Chemical Properties | clear colorless to slightly yellow liquid | | Uses | 4-Fluorophenethylamine may be employed as nucleophile in the synthesis of 2-amino-4-arylpyrimidine derivatives. It is suitable for use in the preparation of ortho-metalated primary phenethylamines having electron-releasing and electron-withdrawing groups on the aromatic ring, leading to complexes containing six membered palladacycles. | | Application | Firstly, ethyl 2-cyano-3,3-dimethythioacrylate was prepared from reactions of ethyl cyanoacetate with carbon disulfide and dimethyl sulfate. Secondly, it reacted with 4-fluorophenethylamine to yield ethyl 2-cyano-3-methythioacrylate-3-[2-(4- fluorophenyl)-ethylamino]-acrylate. | | Precautions | Stable under recommended storage conditions. Incompatible with oxidizing agents and acids. |
| | 4-Fluorophenethylamine Preparation Products And Raw materials |
|