- 1-Fluoro-3-nitrobenzene
-
- $0.00 / 25KG
-
2023-08-18
- CAS:402-67-5
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 50000KG/month
|
| 1-Fluoro-3-nitrobenzene Basic information |
| 1-Fluoro-3-nitrobenzene Chemical Properties |
Melting point | 1.7 °C (lit.) | Boiling point | 205 °C (lit.) | density | 1.325 g/mL at 25 °C (lit.) | RTECS | DA1385000 | refractive index | n20/D 1.525(lit.) | Fp | 170 °F | storage temp. | Inert atmosphere,2-8°C | form | clear liquid | color | green-yellow | Specific Gravity | 1.325 | Water Solubility | immiscible | BRN | 1862210 | InChI | InChI=1S/C6H4FNO2/c7-5-2-1-3-6(4-5)8(9)10/h1-4H | InChIKey | WMASLRCNNKMRFP-UHFFFAOYSA-N | SMILES | C1(F)=CC=CC([N+]([O-])=O)=C1 | CAS DataBase Reference | 402-67-5(CAS DataBase Reference) | NIST Chemistry Reference | Benzene, 1-fluoro-3-nitro-(402-67-5) |
Hazard Codes | T,Xi,Xn | Risk Statements | 23/24/25-33-20/21/22 | Safety Statements | 36/37-45-36 | RIDADR | UN 2810 6.1/PG 2 | WGK Germany | 3 | Hazard Note | Toxic/Irritant | HazardClass | 6.1 | PackingGroup | III | HS Code | 29049085 |
| 1-Fluoro-3-nitrobenzene Usage And Synthesis |
Chemical Properties | clear brown liquid | Uses | 1-Fluoro-3-nitrobenzene was used as an internal standard in the regiospecific silver-mediated fluorination of aryl silanes. | Uses | 1-Fluoro-3-nitrobenzene is a di-substitiuted benzene derivative used for the synthesis of fluoroaromatic compounds through fluorodenitration and other pharmaceuticals. |
| 1-Fluoro-3-nitrobenzene Preparation Products And Raw materials |
|