|
|
| | 4-Hydroxy-3-methylbenzaldehyde Basic information |
| | 4-Hydroxy-3-methylbenzaldehyde Chemical Properties |
| Melting point | 118-120 °C (lit.) | | Boiling point | 250.6°C (estimate) | | density | 1.1150 (rough estimate) | | refractive index | 1.5090 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform (Sparingly, Heated), Methanol (Slightly) | | form | Crystalline Powder | | pka | 8.12±0.18(Predicted) | | color | Off-white, tan to brown | | InChI | InChI=1S/C8H8O2/c1-6-4-7(5-9)2-3-8(6)10/h2-5,10H,1H3 | | InChIKey | BAKYASSDAXQKKY-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C(O)C(C)=C1 | | LogP | 1.807 (est) | | CAS DataBase Reference | 15174-69-3(CAS DataBase Reference) | | NIST Chemistry Reference | 4-Hydroxy-3-methylbenzaldehyde(15174-69-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | RIDADR | PG3 | | WGK Germany | 3 | | HS Code | 29124900 |
| | 4-Hydroxy-3-methylbenzaldehyde Usage And Synthesis |
| Uses | 4-Hydroxy-3-methylbenzaldehyde was used in the preparation of a new series of benzothiazole schiff bases which display antitumor activity against cervical cancer. Also used in the synthesis of novel pyrimidine derivatives which possess antibacterial properties against gram-positive and gram-negative bacteria. | | Definition | ChEBI: 4-Hydroxy-3-methylbenzaldehyde is a hydroxybenzaldehyde. |
| | 4-Hydroxy-3-methylbenzaldehyde Preparation Products And Raw materials |
|