|
| Ethyl 5-Bromoindole-2-carboxylate Basic information |
| Ethyl 5-Bromoindole-2-carboxylate Chemical Properties |
Melting point | 165 °C | Boiling point | 394.7±22.0 °C(Predicted) | density | 1.554±0.06 g/cm3(Predicted) | storage temp. | 2-8°C | solubility | soluble in Acetone | pka | 14.05±0.30(Predicted) | form | Solid | color | White to Orange to Green | InChI | InChI=1S/C11H10BrNO2/c1-2-15-11(14)10-6-7-5-8(12)3-4-9(7)13-10/h3-6,13H,2H2,1H3 | InChIKey | LWRLKENDQISGEU-UHFFFAOYSA-N | SMILES | N1C2=C(C=C(Br)C=C2)C=C1C(OCC)=O | CAS DataBase Reference | 16732-70-0(CAS DataBase Reference) |
Hazard Codes | Xi | WGK Germany | 3 | HazardClass | IRRITANT | HS Code | 2933998090 |
| Ethyl 5-Bromoindole-2-carboxylate Usage And Synthesis |
Uses | Ethyl 5-Bromoindole-2-carboxylate is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Ethyl 5-Bromoindole-2-carboxylate Preparation Products And Raw materials |
|