|
|
| | 3-Methylphenylacetic acid Basic information |
| | 3-Methylphenylacetic acid Chemical Properties |
| Melting point | 64-66 °C(lit.) | | Boiling point | 231.72°C (rough estimate) | | density | 1.0858 (rough estimate) | | refractive index | 1.5002 (estimate) | | pka | 4.30±0.10(Predicted) | | form | Shiny Flakes and Chunks | | color | Colorless to off-white | | Water Solubility | Soluble in water. | | BRN | 2043549 | | InChI | InChI=1S/C9H10O2/c1-7-3-2-4-8(5-7)6-9(10)11/h2-5H,6H2,1H3,(H,10,11) | | InChIKey | GJMPSRSMBJLKKB-UHFFFAOYSA-N | | SMILES | C1(CC(O)=O)=CC=CC(C)=C1 | | CAS DataBase Reference | 621-36-3(CAS DataBase Reference) | | NIST Chemistry Reference | m-Tolylacetic acid(621-36-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29163900 |
| | 3-Methylphenylacetic acid Usage And Synthesis |
| Chemical Properties | colorless to off-white shiny flakes and chunks | | Uses | m-Tolylacetic acid is used as a reactant in the diastereoselective preparation of arylmethylene-isoindolinones. | | Definition | ChEBI: A monocarboxylic acid that is acetic acid in which one of the methyl hydrogens is replaced by a 3-methylphenyl group. |
| | 3-Methylphenylacetic acid Preparation Products And Raw materials |
|