2-Fluoro-5-methoxy-4-nitrobenzoic acid
- CAS No.
- 1001345-80-7
- Chemical Name:
- 2-Fluoro-5-methoxy-4-nitrobenzoic acid
- Synonyms
- 2-Fluoro-5-methoxy-4-nitrobenzoic acid;Benzoic acid, 2-fluoro-5-methoxy-4-nitro-
- CBNumber:
- CB13064235
- Molecular Formula:
- C8H6FNO5
- Molecular Weight:
- 215.14
- MDL Number:
- MFCD26395470
- MOL File:
- 1001345-80-7.mol
- MSDS File:
- SDS
| Product description | Number | Pack Size | Price |
| 2-Fluoro-5-methoxy-4-nitrobenzoicAcid | F599623 | 50mg | $65 |
| 2-Fluoro-5-methoxy-4-nitrobenzoicAcid | F599623 | 100mg | $110 |
| 2-Fluoro-5-methoxy-4-nitrobenzoicacid 98% | A189107 | 1g | $129 |
| 2-Fluoro-5-methoxy-4-nitrobenzoicacid 98% | A189107 | 5g | $467 |
| 2-Fluoro-5-methoxy-4-nitrobenzoicacid 95+% | CD12188463 | 5g | $639 |
| Boiling point | 413.0±45.0 °C(Predicted) |
|---|---|
| Density | 1.514±0.06 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| pka | 2.25±0.13(Predicted) |
| Appearance | Off-white to yellow Solid |
| InChI | InChI=1S/C8H6FNO5/c1-15-7-2-4(8(11)12)5(9)3-6(7)10(13)14/h2-3H,1H3,(H,11,12) |
| InChIKey | JXCYBTVSPGQRCM-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(OC)=C([N+]([O-])=O)C=C1F |
SAFETY
Risk and Safety Statements
| Symbol(GHS) |  GHS06 |
|---|---|
| Signal word | Danger |
| Hazard statements | H301-H311-H331 |
| Precautionary statements | P261-P264-P270-P271-P280-P302+P352-P304+P340-P310-P330-P361-P403+P233-P405-P501 |
2-Fluoro-5-methoxy-4-nitrobenzoic acid price
| Manufacturer | Product number | Product description | CAS number | Packaging | Price | Updated | Buy |
|---|---|---|---|---|---|---|---|
| TRC | F599623 | 2-Fluoro-5-methoxy-4-nitrobenzoicAcid | 1001345-80-7 | 50mg | $65 | 2021-12-16 | Buy |
| TRC | F599623 | 2-Fluoro-5-methoxy-4-nitrobenzoicAcid | 1001345-80-7 | 100mg | $110 | 2021-12-16 | Buy |
| Ambeed | A189107 | 2-Fluoro-5-methoxy-4-nitrobenzoicacid 98% | 1001345-80-7 | 1g | $129 | 2021-12-16 | Buy |
| Ambeed | A189107 | 2-Fluoro-5-methoxy-4-nitrobenzoicacid 98% | 1001345-80-7 | 5g | $467 | 2021-12-16 | Buy |
| Crysdot | CD12188463 | 2-Fluoro-5-methoxy-4-nitrobenzoicacid 95+% | 1001345-80-7 | 5g | $639 | 2021-12-16 | Buy |
2-Fluoro-5-methoxy-4-nitrobenzoic acid Chemical Properties,Uses,Production
Synthesis
2-Fluoro-5-methoxy-4-nitrobenzoic acid can be synthesized using various methods such as the Friedel-Crafts acylation reaction, the Suzuki-Miyaura coupling reaction, and the Buchwald-Hartwig amination reaction. The Friedel-Crafts acylation reaction involves the reaction of 2-fluoro-5-methoxy-4-nitrobenzoyl chloride with methanol in the presence of a catalyst such as aluminum chloride. The Suzuki-Miyaura coupling reaction involves the reaction of 2-fluoro-5-methoxy-4-nitrophenylboronic acid with 4-chlorobenzoic acid in the presence of a palladium catalyst. The Buchwald-Hartwig amination reaction involves the reaction of 2-fluoro-5-methoxy-4-nitroiodobenzene with potassium phthalimide in the presence of a palladium catalyst.
2-Fluoro-5-methoxy-4-nitrobenzoic acid Preparation Products And Raw materials
2-Fluoro-5-methoxy-4-nitrobenzoic acid Suppliers
| Supplier | Tel | Country | ProdList | Advantage | |
|---|---|---|---|---|---|
| Career Henan Chemica Co | +86-0371-86658258 +8613203830695 | laboratory@coreychem.com | China | 30228 | 58 |
| Shanghai Gubang New Materail Technology Co. LTD | 21-51317962 +8618721305404 | 16728589@qq.com | CHINA | 272 | 58 |
| Hefei TNJ Chemical Industry Co.,Ltd. | +86-0551-65418684 +8618949823763 | sales@tnjchem.com | China | 25356 | 58 |
| Aladdin Scientific | tp@aladdinsci.com | United States | 52923 | 58 | |
| Suzhou ARTK Medchem Co., Ltd. | +8618118463618 | sales1@artkmedchem.com | China | 39020 | 58 |
| Nanjing Asfam Pharmaceutical Technology Co., Ltd. | 18751812725 | sales@ace-pharm.com | China | 1970 | 58 |
| Nanjing Habo Medical Technology Co., Ltd. | 13376080562 13376090521 | sales@habotech.com | China | 890 | 60 |
| ShangHai AmK Pharmaceutical Technology Co., Ltd. | 微信 17321281695 18019252918 | sale@amkchem.com | China | 14994 | 55 |
| Shanghai YuanQi Biotechnology Co., Ltd. | +86-2332782371 +86-18120098618 | sales@adobechem.com | China | 1250 | 50 |
| SuZhou ShiYa Biopharmaceuticals, Inc. | 0512-0512-52358471 17715136450 | sales@shiyabiopharm.com | China | 12127 | 58 |
