| Melting point: |
-126.2°C |
| Boiling point: |
118-119 °C (lit.) |
| Density |
1.216 g/mL at 25 °C (lit.) |
| refractive index |
n20/D 1.445(lit.) |
| Flash point: |
65 °F |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
Miscible with ethanol, ether, benzene and chloroform. |
| form |
Liquid |
| color |
Clear pale yellow |
| BRN |
1730967 |
| Dielectric constant |
8.3699999999999992 |
| InChI |
InChI=1S/C5H11Br/c1-3-5(6)4-2/h5H,3-4H2,1-2H3 |
| InChIKey |
VTOQFOCYBTVOJZ-UHFFFAOYSA-N |
| SMILES |
CCC(Br)CC |
| CAS DataBase Reference |
1809-10-5(CAS DataBase Reference) |
| EPA Substance Registry System |
Pentane, 3-bromo- (1809-10-5) |