| Melting point: |
79-82 °C(lit.) |
| Boiling point: |
185-186 °C18 mm Hg(lit.) |
| Density |
1.1963 (rough estimate) |
| refractive index |
1.4900 (estimate) |
| storage temp. |
Keep in dark place,Sealed in dry,Room Temperature |
| form |
powder to crystal |
| color |
Light yellow to Amber to Dark green |
| BRN |
1954310 |
| InChI |
InChI=1S/C11H9NO2/c1-8-6-7-9-4-2-3-5-10(9)11(8)12(13)14/h2-7H,1H3 |
| InChIKey |
IZNWACYOILBFEG-UHFFFAOYSA-N |
| SMILES |
C1([N+]([O-])=O)=C2C(C=CC=C2)=CC=C1C |
| CAS DataBase Reference |
881-03-8(CAS DataBase Reference) |
| EPA Substance Registry System |
1-Nitro-2-methylnaphthalene (881-03-8) |