| Melting point: |
210-215 °C (dec.)(lit.) |
| Boiling point: |
301.8±42.0 °C(Predicted) |
| Density |
1.7500 (estimate) |
| storage temp. |
Store below +30°C. |
| solubility |
Soluble in benzene, methanol, acetic acid and dioxane.Slightly soluble in chloroform,, dichloromethane. |
| form |
Crystalline Powder or Crystals |
| color |
Yellow to orange |
| Water Solubility |
reacts |
| Sensitive |
Moisture Sensitive |
| Merck |
14,3063 |
| BRN |
747939 |
| InChI |
1S/C8Cl2N2O2/c9-5-6(10)8(14)4(2-12)3(1-11)7(5)13 |
| InChIKey |
HZNVUJQVZSTENZ-UHFFFAOYSA-N |
| SMILES |
ClC1=C(Cl)C(=O)C(C#N)=C(C#N)C1=O |
| CAS DataBase Reference |
84-58-2(CAS DataBase Reference) |
| NIST Chemistry Reference |
1,4-Cyclohexadiene-1,2-dicarbonitrile, 4,5-dichloro-3,6-dioxo-(84-58-2) |
| EPA Substance Registry System |
1,4-Cyclohexadiene-1,2-dicarbonitrile, 4,5-dichloro-3,6-dioxo- (84-58-2) |