| Melting point: |
741 °C (lit.) |
| Boiling point: |
1575°C |
| bulk density |
700kg/m3 |
| Density |
2.367 g/mL at 25 °C (lit.) |
| vapor pressure |
7.3 hPa (1200 °C) |
| refractive index |
1.501 |
| Flash point: |
1575°C |
| storage temp. |
Store at +5°C to +30°C. |
| solubility |
H2O: 0.1 M at 20 °C, clear, colorless |
| form |
Solid |
| Specific Gravity |
2.367 |
| color |
White |
| PH |
9.0-10.5 (25℃, 0.1M in H2O) |
| Water Solubility |
26 g/L (20 ºC) |
| Sensitive |
Hygroscopic |
| λmax |
λ: 260 nm Amax: ≤0.020
λ: 280 nm Amax: ≤0.015 |
| Merck |
14,8590 |
| Exposure limits |
ACGIH: TWA 2 mg/m3; STEL 6 mg/m3
NIOSH: TWA 1 mg/m3 |
| Stability: |
Stable. Incompatible with powdered metals. |
| Major Application |
forensics and toxicology |
| Cosmetics Ingredients Functions |
BUFFERING |
| InChI |
1S/B4O7.2Na/c5-1-7-3-9-2(6)10-4(8-1)11-3;;/q-2;2*+1 |
| InChIKey |
UQGFMSUEHSUPRD-UHFFFAOYSA-N |
| SMILES |
[Na+].[Na+].[O-]B1Ob2ob([O-])ob(O1)o2 |
| NIST Chemistry Reference |
Sodium borate(1330-43-4) |
| EPA Substance Registry System |
Sodium tetraborate (1330-43-4) |