| Melting point: |
26 °C(lit.) |
| Boiling point: |
150 °C(lit.) |
| Density |
1.22 g/mL at 25 °C(lit.) |
| vapor pressure |
0.038Pa at 25℃ |
| refractive index |
n20/D 1.5110(lit.) |
| Flash point: |
130 °F |
| form |
liquid |
| Specific Gravity |
1.21 |
| color |
pale yellow to amber |
| Hydrolytic Sensitivity |
4: no reaction with water under neutral conditions |
| Exposure limits |
ACGIH: TWA 0.1 mg/m3; STEL 0.2 mg/m3 (Skin) NIOSH: IDLH 25 mg/m3; TWA 0.1 mg/m3 |
| InChI |
InChI=1S/2C5H8O2.2C4H9.Sn/c2*1-4(6)3-5(2)7;2*1-3-4-2;/h2*3,6H,1-2H3;2*1,3-4H2,2H3;/q;;;;+2/p-2/b2*4-3-;;; |
| InChIKey |
UVDDHYAAWVNATK-VGKOASNMSA-L |
| SMILES |
[Sn](CCCC)(CCCC)(O/C(/C)=C\C(=O)C)O/C(/C)=C\C(=O)C |
| EPA Substance Registry System |
Tin, dibutylbis(2,4-pentanedionato-.kappa.O2,.kappa.O4)-, (OC-6-11)- (22673-19-4) |