| | 2-Nitrobenzenesulfonyl chloride Basic information |
| | 2-Nitrobenzenesulfonyl chloride Chemical Properties |
| Melting point | 63-67 °C(lit.) | | Boiling point | 350.6±25.0 °C(Predicted) | | density | 1.606±0.06 g/cm3(Predicted) | | storage temp. | Store below +30°C. | | form | powder to crystal | | color | White to Yellow to Orange | | Water Solubility | Soluble in toluene, tetrahydrofuran, methylene chloride, ethyl acetate and dimethylformamide. Insoluble in water. | | Sensitive | Moisture Sensitive | | BRN | 521155 | | InChI | InChI=1S/C6H4ClNO4S/c7-13(11,12)6-4-2-1-3-5(6)8(9)10/h1-4H | | InChIKey | WPHUUIODWRNJLO-UHFFFAOYSA-N | | SMILES | C1(S(Cl)(=O)=O)=CC=CC=C1[N+]([O-])=O | | CAS DataBase Reference | 1694-92-4(CAS DataBase Reference) | | EPA Substance Registry System | Benzenesulfonyl chloride, 2-nitro- (1694-92-4) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8/PG 2 | | WGK Germany | 3 | | F | 21 | | Hazard Note | Corrosive/Moisture Sensitive | | TSCA | Yes | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29049090 |
| | 2-Nitrobenzenesulfonyl chloride Usage And Synthesis |
| Chemical Properties | Off-white tot yellow crystalline powder | | Uses | 2-Nitrobenzenesulfonyl chloride acts as a reagent to form 2-nitrobenzenesulfonyl derivatives of alcohols and amines. It is also involved in the selective cleavage with thiophenol without displacement of the nitro group. Further, it is used in the preparation of renin inhibitors. In addition to this, it finds application as an anticonvulsant. | | Production Methods | 2-Nitrobenzenesulfonyl chloride is isolated as an intermediate in the production of 2-nitrobenzenesulfonic acid. When 2,2' - dinitrodiphenyl disulfide is chlorinated in an organic solvent the product is 2-nitrophenylsulfenyl chloride. |
| | 2-Nitrobenzenesulfonyl chloride Preparation Products And Raw materials |
|