2,3-DIHYDROXYPROPYL ACRYLATE manufacturers
|
| 2,3-DIHYDROXYPROPYL ACRYLATE Basic information |
Product Name: | 2,3-DIHYDROXYPROPYL ACRYLATE | Synonyms: | Acrylic acid 2,3-dihydroxypropyl ester;Glycerin 1-acrylate;Glycerol 1-acrylate;Einecs 233-228-6;GLYCERYL MONOACRYLATE;2,3-DIHYDROXYPROPYL ACRYLATE;2,3-Dihydroxypropyl acrylate (Glyceryl mono-acrylate);2,3-dihydroxypropyl prop-2-enoate | CAS: | 10095-20-2 | MF: | C6H10O4 | MW: | 146.14 | EINECS: | 233-228-6 | Product Categories: | monomer | Mol File: | 10095-20-2.mol |  |
| 2,3-DIHYDROXYPROPYL ACRYLATE Chemical Properties |
Boiling point | 300.7±32.0 °C(Predicted) | density | 1.202±0.06 g/cm3(Predicted) | pka | 13.11±0.20(Predicted) | InChI | InChI=1S/C6H10O4/c1-2-6(9)10-4-5(8)3-7/h2,5,7-8H,1,3-4H2 | InChIKey | OWPUOLBODXJOKH-UHFFFAOYSA-N | SMILES | C(OCC(O)CO)(=O)C=C |
| 2,3-DIHYDROXYPROPYL ACRYLATE Usage And Synthesis |
Uses | 2,3-Dihydroxypropyl acrylate is a synthetic or pharmaceutical intermediate used in the preparation of drugs for diseases such as cancer and cardiovascular abnormalities, and also in the preparation of drug delivery materials. |
| 2,3-DIHYDROXYPROPYL ACRYLATE Preparation Products And Raw materials |
|