(+/-)-EXO EXO-2 3-CAMPHANEDIOL manufacturers
|
| (+/-)-EXO EXO-2 3-CAMPHANEDIOL Basic information |
Product Name: | (+/-)-EXO EXO-2 3-CAMPHANEDIOL | Synonyms: | (1R,2S,3R,4S)-rel-1,7,7-Trimethylbicyclo[2.2.1]heptane-2,3-diol;(+/-)-exo,exo-2,3-Camphanediol 97%;(+/-)-EXO EXO-2 3-CAMPHANEDIOL 97;(1R,2S,3R,4S)-1,7,7-Trimethylnorbornane-2,3-diol;Bicyclo[2.2.1]heptane-2,3-diol, 1,7,7-trimethyl-, (1R,2S,3R,4S)-rel-;(+/-)-exo,exo-2,3-Camphanediol;CAMPHANEDIOL;(+/-)-EXO EXO-2 3-CAMPHANEDIOL 97 | CAS: | 56614-57-4 | MF: | C10H18O2 | MW: | 170.25 | EINECS: | | Product Categories: | Building Blocks;Chemical Synthesis;Organic Building Blocks;Oxygen Compounds;Organic Building Blocks;Oxygen Compounds;Polyols | Mol File: | 56614-57-4.mol |  |
| (+/-)-EXO EXO-2 3-CAMPHANEDIOL Chemical Properties |
Melting point | 262-268 °C | Boiling point | 261.7±8.0 °C(Predicted) | density | 1.117±0.06 g/cm3(Predicted) | storage temp. | 2-8°C | pka | 14.80±0.70(Predicted) | form | solid | InChI | InChI=1/C10H18O2/c1-9(2)6-4-5-10(9,3)8(12)7(6)11/h6-8,11-12H,4-5H2,1-3H3/t6-,7-,8-,10+/s3 | InChIKey | AYEOSGBMQHXVER-ITFDYHJONA-N | SMILES | [C@]12(C)C(C)(C)[C@]([H])(CC1)[C@@H](O)[C@H]2O |&1:0,5,9,11,r| | LogP | 1.520 (est) | CAS DataBase Reference | 56614-57-4 |
Hazard Codes | Xi | Risk Statements | 41 | Safety Statements | 26-39 | WGK Germany | 2 | HS Code | 2906190090 |
| (+/-)-EXO EXO-2 3-CAMPHANEDIOL Usage And Synthesis |
| (+/-)-EXO EXO-2 3-CAMPHANEDIOL Preparation Products And Raw materials |
|