|
|
| | Acyclovir IMpurity C Basic information |
| | Acyclovir IMpurity C Chemical Properties |
| Melting point | >280 °C (decomp) | | density | 1.77±0.1 g/cm3(Predicted) | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | pka | 9.46±0.20(Predicted) | | form | Solid | | color | White to Pale Yellow | | InChI | InChI=1S/C8H11N5O3/c9-8-11-6-5(7(15)12-8)13(3-10-6)4-16-2-1-14/h3,14H,1-2,4H2,(H3,9,11,12,15) | | InChIKey | ZEJSSOYUBQMVHC-UHFFFAOYSA-N | | SMILES | N1(COCCO)C2=C(N=C(N)NC2=O)N=C1 |
| | Acyclovir IMpurity C Usage And Synthesis |
| Uses | N7-[(2-Hydroxyethoxy)methyl)guanine is the 7-isomeric impurity of the antiviral drug Acyclovir (A192400). |
| | Acyclovir IMpurity C Preparation Products And Raw materials |
|