|
|
| | 2,3-DibroMo-1,4-difluorobenzene Basic information |
| | 2,3-DibroMo-1,4-difluorobenzene Chemical Properties |
| Boiling point | 216.3±35.0 °C(Predicted) | | density | 2.087±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | crystals | | color | Off white to cream | | InChI | InChI=1S/C6H2Br2F2/c7-5-3(9)1-2-4(10)6(5)8/h1-2H | | InChIKey | TXTZEQOJTJIFAH-UHFFFAOYSA-N | | SMILES | C1(F)=CC=C(F)C(Br)=C1Br |
| | 2,3-DibroMo-1,4-difluorobenzene Usage And Synthesis |
| Uses | 2,?3-?Dibromo-?1,?4-?difluorobenzene is a reagent used in the synthesis of pharmaceuticals and electronic organic devices. |
| | 2,3-DibroMo-1,4-difluorobenzene Preparation Products And Raw materials |
|