|
|
| | (S)-BOC-4-CYANO-BETA-PHE-OH Basic information |
| Product Name: | (S)-BOC-4-CYANO-BETA-PHE-OH | | Synonyms: | (s)-boc-4-cyano-β-phe-oh;Boc-b-Phe(4-CN)-OH;(S)-3-(Boc-amino)-3-(4-cyanophenyl)propionic acid, Boc-4-cyano-D-β-phenylalanine;(betaS)-4-Cyano-beta-[[(tert-butoxy)carbonyl]amino]benzenepropanoic acid;(S)-Boc-β-Phe(4-CN)-OH;(S)-3-(tert-butoxycarbonylamino)-3-(4-cyanophenyl)propanoic acid;(3S)-3-{[(tert-butoxy)carbonyl]amino}-3-(4-cyanophenyl)propanoic acid;(Tert-Butoxy)Carbonyl (S)-3-Amino-3-(4-cyano-phenyl)propionic acid | | CAS: | 500770-82-1 | | MF: | C15H18N2O4 | | MW: | 290.31 | | EINECS: | | | Product Categories: | | | Mol File: | 500770-82-1.mol |  |
| | (S)-BOC-4-CYANO-BETA-PHE-OH Chemical Properties |
| Melting point | 127℃ | | Boiling point | 491.5±45.0 °C(Predicted) | | density | 1.22 | | storage temp. | Sealed in dry,Room Temperature | | pka | 4.17±0.10(Predicted) | | Appearance | White to off-white Solid | | Optical Rotation | Consistent with structure | | Major Application | peptide synthesis | | InChI | 1S/C15H18N2O4/c1-15(2,3)21-14(20)17-12(8-13(18)19)11-6-4-10(9-16)5-7-11/h4-7,12H,8H2,1-3H3,(H,17,20)(H,18,19)/t12-/m0/s1 | | InChIKey | PYMTTWVQVSELBI-LBPRGKRZSA-N | | SMILES | CC(C)(C)OC(=O)N[C@@H](CC(O)=O)c1ccc(cc1)C#N |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (S)-BOC-4-CYANO-BETA-PHE-OH Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | (S)-BOC-4-CYANO-BETA-PHE-OH Preparation Products And Raw materials |
|