|
| 4-Methoxy-1H-indole-2-carboxylic acid Basic information |
| 4-Methoxy-1H-indole-2-carboxylic acid Chemical Properties |
Melting point | 234-235 °C | Boiling point | 447.6±25.0 °C(Predicted) | density | 1.381±0.06 g/cm3(Predicted) | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | form | solid | pka | 4.52±0.30(Predicted) | color | Yellow | InChI | InChI=1S/C10H9NO3/c1-14-9-4-2-3-7-6(9)5-8(11-7)10(12)13/h2-5,11H,1H3,(H,12,13) | InChIKey | ZZAVIQXQBBOHBB-UHFFFAOYSA-N | SMILES | N1C2=C(C(OC)=CC=C2)C=C1C(O)=O | CAS DataBase Reference | 103260-65-7(CAS DataBase Reference) |
Hazard Codes | Xi | Risk Statements | 36/37/38 | Safety Statements | 26-36/37/39 | HazardClass | IRRITANT | HS Code | 2933998090 |
| 4-Methoxy-1H-indole-2-carboxylic acid Usage And Synthesis |
| 4-Methoxy-1H-indole-2-carboxylic acid Preparation Products And Raw materials |
|