- 3-BROMO-5-NITROANISOLE
-
- $1.00 / 1KG
-
2019-08-08
- CAS:16618-67-0
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 100KG
|
| | 3-BROMO-5-NITROANISOLE Basic information |
| Product Name: | 3-BROMO-5-NITROANISOLE | | Synonyms: | 3-BROMO-5-NITROANISOLE;3-BROMO-5-NITROANISOL;3-BROMO-5-NITROANISOL, 97.5+%;1-Bromo-3-methoxy-5-nitrobenzene;Benzene, 1-bromo-3-methoxy-5-nitro-;1-Bromo-3-methoxy-5-nitrobenzene, 3-Bromo-5-nitrophenyl methyl ether;1-BroMo-5-Nitroanizole;1-Bromo-3-methoxy-5-nitrobenzene, 3-Bromo-5-nitrophenyl methyl | | CAS: | 16618-67-0 | | MF: | C7H6BrNO3 | | MW: | 232.03 | | EINECS: | | | Product Categories: | Naphthyridine,Quinoline | | Mol File: | 16618-67-0.mol |  |
| | 3-BROMO-5-NITROANISOLE Chemical Properties |
| Melting point | 86.0 to 90.0 °C | | Boiling point | 295.3±20.0 °C(Predicted) | | density | 1.640±0.06 g/cm3(Predicted) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | powder to crystal | | color | White to Orange to Green | | InChI | InChI=1S/C7H6BrNO3/c1-12-7-3-5(8)2-6(4-7)9(10)11/h2-4H,1H3 | | InChIKey | MEQKSFQEPDRNEQ-UHFFFAOYSA-N | | SMILES | C1(Br)=CC([N+]([O-])=O)=CC(OC)=C1 |
| | 3-BROMO-5-NITROANISOLE Usage And Synthesis |
| Chemical Properties | brown solid |
| | 3-BROMO-5-NITROANISOLE Preparation Products And Raw materials |
|