ATRAZINE manufacturers
- ATRAZINE
-
- $1.00 / 1KG
-
2020-01-13
- CAS:102029-43-6
- Min. Order: 1g
- Purity: 99.0%
- Supply Ability: 100kg
- ATRAZINE
-
- $1.00 / 25Kg/Drum
-
2019-10-30
- CAS:102029-43-6
- Min. Order: 25Kg/Drum
- Purity: 99%
- Supply Ability: 1ton
|
| | ATRAZINE Basic information |
| Product Name: | ATRAZINE | | Synonyms: | AATREX;AATREX(R);2-CHLORO-4-ETHYLAMINO-6-ISOPROPYL-AMINO-S-TRIAZINE;2-CHLORO-4-ETHYLAMINO-6-ISOPROPYLAMINO-SYM-TRIAZINE;TIMTEC-BB SBB003393;PRIMAGRAM;PRIMEXTRA;N2-ETHYL-N4-ISOPROPYL-6-CHLORO-1,3,5-TRIAZINE-2,4-DIAMINE | | CAS: | 102029-43-6 | | MF: | C8H14ClN5 | | MW: | 215.68 | | EINECS: | | | Product Categories: | | | Mol File: | 102029-43-6.mol |  |
| | ATRAZINE Chemical Properties |
| storage temp. | 2-8°C | | form | solid | | InChI | InChI=1S/C8H14ClN5/c1-4-10-7-12-6(9)13-8(14-7)11-5(2)3/h5H,4H2,1-3H3,(H2,10,11,12,13,14) | | InChIKey | MXWJVTOOROXGIU-UHFFFAOYSA-N | | SMILES | C1(NC(C)C)=NC(=NC(NCC)=N1)Cl | | CAS DataBase Reference | 102029-43-6(CAS DataBase Reference) |
| Hazard Codes | Xn,R | | Risk Statements | 22-41-43-48/22 | | Safety Statements | 26-36 | | RIDADR | UN 2910 7 | | WGK Germany | 3 | | HS Code | 28444080 |
| | ATRAZINE Usage And Synthesis |
| Chemical Properties | white Crystalline powder |
| | ATRAZINE Preparation Products And Raw materials |
|