- Ferrous acetylacetonate
-
- $0.00 / 25KG
-
2025-03-19
- CAS:14024-17-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 50000KG/month
|
| | Ferrous acetylacetonate Basic information |
| Product Name: | Ferrous acetylacetonate | | Synonyms: | (Acetylacetonato)iron;(Acetylacetonato)iron (ii);bis(1,4-Pentanedionato) iron;Bis(2,4-pentanedionato)iron;bis(2,4-pentanedionato-O,O’)-Iron;Bis(acetylacetonato)iron;Ferroacetylacetonate;Iron bis(acetylacetonate) | | CAS: | 14024-17-0 | | MF: | C10H14FeO4 | | MW: | 254.06 | | EINECS: | 237-851-4 | | Product Categories: | | | Mol File: | 14024-17-0.mol |  |
| | Ferrous acetylacetonate Chemical Properties |
| Melting point | 175 °C (dec.)(lit.) | | storage temp. | Inert atmosphere,Room Temperature | | solubility | slightly soluble in benzene, toluene | | color | orange-brown crystals, crystalline | | InChI | InChI=1S/2C5H8O2.Fe/c2*1-4(6)3-5(2)7;/h2*3,6H,1-2H3;/q;;+2/p-2/b2*4-3-; | | InChIKey | LFORAFQNBQKDRY-FDGPNNRMSA-L | | SMILES | O([Fe]O/C(/C)=C\C(=O)C)/C(/C)=C\C(=O)C | | CAS DataBase Reference | 14024-17-0(CAS DataBase Reference) | | NIST Chemistry Reference | Bis(acetylacetonate)iron(14024-17-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 |
| | Ferrous acetylacetonate Usage And Synthesis |
| Chemical Properties | dark brown powder | | Definition | Ferrous acetylacetonate (Iron(II) Acetylacetonate) is an Iron source soluble in organic solvents as an organometallic compound. The high-purity acetylacetonate anion complexes by bonding each oxygen atom to the metallic cation to form a chelate ring; because of this property, acetylacetonates are commonly used in various catalysts and catalytic reagents for organic synthesis, including the fabrication of various shapes of carbon nanostructures via the use of chemical vapour deposition (CVD) and laser evaporation techniques. The numerous commercial applications for Iron include primary colourant in glass and ceramics, catalyst, the basis for low-grade magnets, and, because of its magnetic properties, is used extensively in memory tape.
|
| | Ferrous acetylacetonate Preparation Products And Raw materials |
|