| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | 6-Fluoro-4-hydroxy-2-(trifluoromethyl)quinoline Basic information |
| Product Name: | 6-Fluoro-4-hydroxy-2-(trifluoromethyl)quinoline | | Synonyms: | BUTTPARK 37\04-03;6-Fluoro-2-(trifluoromethyl)quinolin-4-ol;6-fluoro-2-(trifluoromethyl)-1H-quinolin-4-one;6-fluoro-2-(trifluoromethyl)-4-quinolone;6-Fluoro-4-hydroxy-2-(trifluoromethyl)quinoline 97%;6-Fluoro-4-hydroxy-2-(trifluoromethyl)quinoline97%;6-Fluoro-2-(trifluoromethyl)quinolin-4(1h)-one;4-Quinolinol, 6-fluoro-2-(trifluoromethyl)- | | CAS: | 31009-34-4 | | MF: | C10H5F4NO | | MW: | 231.15 | | EINECS: | 202-110-6 | | Product Categories: | | | Mol File: | 31009-34-4.mol |  |
| | 6-Fluoro-4-hydroxy-2-(trifluoromethyl)quinoline Chemical Properties |
| Melting point | 259-263°C | | Boiling point | 302.9±37.0 °C(Predicted) | | density | 1.511±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 6.40±0.40(Predicted) | | form | solid | | Appearance | White to off-white Solid | | InChI | 1S/C10H5F4NO/c11-5-1-2-7-6(3-5)8(16)4-9(15-7)10(12,13)14/h1-4H,(H,15,16) | | InChIKey | FNDABQIPEQHTNR-UHFFFAOYSA-N | | SMILES | Oc1cc(nc2ccc(F)cc12)C(F)(F)F | | CAS DataBase Reference | 31009-34-4(CAS DataBase Reference) |
| Hazard Codes | Xi,T | | Risk Statements | 36/37/38-25 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | WGK 3 | | Hazard Note | Irritant | | HazardClass | 6.1 | | HS Code | 29334900 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral |
| | 6-Fluoro-4-hydroxy-2-(trifluoromethyl)quinoline Usage And Synthesis |
| Chemical Properties | Light pink solid | | Uses | 6-Fluoro--4-hydroxy-2-(trifluoromethyl)quinoline |
| | 6-Fluoro-4-hydroxy-2-(trifluoromethyl)quinoline Preparation Products And Raw materials |
|