|
|
| | 4-Hydroxyphenylglycolic acid Basic information |
| Product Name: | 4-Hydroxyphenylglycolic acid | | Synonyms: | RARECHEM AL BO 0522;P-HYDROXY MANDELIC ACID;4-HYDROXYMANDELIC ACID 97% HPLC;(4-Hydroxyphenyl)hydroxyacetic acid;2-(4-Hydroxyphenyl)-2-hydroxyacetic acid;4,α-Dihydroxybenzeneacetic acid;DL-4-Hydroxymandelic acid,95%;2-hydroxy-2-(4-hydroxyphenyl)acetic acid hydrate | | CAS: | 1198-84-1 | | MF: | C8H8O4 | | MW: | 168.15 | | EINECS: | 214-839-7 | | Product Categories: | | | Mol File: | 1198-84-1.mol |  |
| | 4-Hydroxyphenylglycolic acid Chemical Properties |
| Melting point | 82-85 °C(lit.) | | Boiling point | 405.4±30.0 °C(Predicted) | | density | 1.480±0.06 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | Soluble in DMSO | | pka | 3.51±0.10(Predicted) | | form | Solid | | color | White to pink | | InChI | InChI=1S/C8H8O4/c9-6-3-1-5(2-4-6)7(10)8(11)12/h1-4,7,9-10H,(H,11,12) | | InChIKey | YHXHKYRQLYQUIH-UHFFFAOYSA-N | | SMILES | C(O)(=O)C(C1=CC=C(O)C=C1)O | | CAS DataBase Reference | 1198-84-1(CAS DataBase Reference) | | EPA Substance Registry System | Benzeneacetic acid, ?,4-dihydroxy- (1198-84-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 |
| | 4-Hydroxyphenylglycolic acid Usage And Synthesis |
| Chemical Properties | off-white crystalline powder | | Uses | 4-Hydroxymandelic Acid is a useful synthetic intermediate in the synthesis of Hydroxyatenolol (H802480); a metabolite of Atenolol (A790075) which is a cardioselective β-adrenergic blocker, antihypertensive, antianginal, and antiarrhythmic (class II). | | Definition | ChEBI: A 2-hydroxy carboxylic acid that is mandelic acid bearing a phenolic hydroxy substituent at position 4. |
| | 4-Hydroxyphenylglycolic acid Preparation Products And Raw materials |
|