|
|
| | Methyl 5-bromo-2-methyl-1,3-thiazole-4-carboxylate Basic information |
| Product Name: | Methyl 5-bromo-2-methyl-1,3-thiazole-4-carboxylate | | Synonyms: | Methyl 5-bromo-2-methylthiazole-4-carboxylate≥ 95% (HPLC);Methyl 5-bromo-2-methyl-1,3-thiazole-4-carboxylate;5-Bromo-4-(methoxycarbonyl)-2-methyl-1,3-thiazole;5-bromo-2-methylthiazole-4-carboxylicacidmethylester;4-Thiazolecarboxylic acid, 5-bromo-2-methyl-, methyl ester | | CAS: | 899897-21-3 | | MF: | C6H6BrNO2S | | MW: | 236.09 | | EINECS: | | | Product Categories: | | | Mol File: | 899897-21-3.mol |  |
| | Methyl 5-bromo-2-methyl-1,3-thiazole-4-carboxylate Chemical Properties |
| Boiling point | 278.5±20.0 °C(Predicted) | | density | 1.656±0.06 g/cm3(Predicted) | | storage temp. | Store at Room Tem. | | pka | -0.76±0.10(Predicted) | | InChI | InChI=1S/C6H6BrNO2S/c1-3-8-4(5(7)11-3)6(9)10-2/h1-2H3 | | InChIKey | FINAXYSMTLVVOE-UHFFFAOYSA-N | | SMILES | S1C(Br)=C(C(OC)=O)N=C1C |
| Hazard Codes | Xi | | HS Code | 2934100090 |
| | Methyl 5-bromo-2-methyl-1,3-thiazole-4-carboxylate Usage And Synthesis |
| Chemical Properties | Light yellow to brown solid |
| | Methyl 5-bromo-2-methyl-1,3-thiazole-4-carboxylate Preparation Products And Raw materials |
|