Bicyclo[4.2.0]octane-1,3,5-triene-7-ol manufacturers
|
| | Bicyclo[4.2.0]octane-1,3,5-triene-7-ol Basic information |
| Product Name: | Bicyclo[4.2.0]octane-1,3,5-triene-7-ol | | Synonyms: | 1,2-Ethanobenzene-7-ol;Bicyclo[4.2.0]octa-1(6),2,4-triene-7-ol;Bicyclo[4.2.0]octa-1,3,5-trien-7-ol;Bicyclo[4.2.0]octane-1,3,5-triene-7-ol;1-Hydroxy-Benzocyclobutene;1,2-Dihydrobenzocyclobuten-1-ol;1-Hydroxycyclobutabenzene;Benzocyclobuten-1-ol | | CAS: | 35447-99-5 | | MF: | C8H8O | | MW: | 120.15 | | EINECS: | | | Product Categories: | | | Mol File: | 35447-99-5.mol | ![Bicyclo[4.2.0]octane-1,3,5-triene-7-ol Structure](CAS/GIF/35447-99-5.gif) |
| | Bicyclo[4.2.0]octane-1,3,5-triene-7-ol Chemical Properties |
| Melting point | 62-63 °C | | Boiling point | 244.2±19.0 °C(Predicted) | | density | 1.228±0.06 g/cm3(Predicted) | | pka | 14.36±0.20(Predicted) | | InChI | InChI=1S/C8H8O/c9-8-5-6-3-1-2-4-7(6)8/h1-4,8-9H,5H2 | | InChIKey | SKLKSDFOCXHYOO-UHFFFAOYSA-N | | SMILES | C12C(C(O)C1)=CC=CC=2 |
| | Bicyclo[4.2.0]octane-1,3,5-triene-7-ol Usage And Synthesis |
| Synthesis Reference(s) | The Journal of Organic Chemistry, 46, p. 2730, 1981 DOI: 10.1021/jo00326a026 |
| | Bicyclo[4.2.0]octane-1,3,5-triene-7-ol Preparation Products And Raw materials |
|