|
|
| | Bis(triphenylphosphinepalladium) acetate Basic information |
| | Bis(triphenylphosphinepalladium) acetate Chemical Properties |
| Melting point | 136 °C (dec.)(lit.) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | form | Powder | | color | Yellow | | Stability: | store cold | | InChI | InChI=1S/2C18H15P.2C2H4O2.Pd/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2*1-2(3)4;/h2*1-15H;2*1H3,(H,3,4);/q;;;;+2/p-2 | | InChIKey | OZELLBKLLRMCRL-UHFFFAOYSA-M | | SMILES | P(C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1.P(C1C=CC=CC=1)(C1=CC=CC=C1)C1=CC=CC=C1.O(C(=O)C)[Pd]OC(=O)C |
| | Bis(triphenylphosphinepalladium) acetate Usage And Synthesis |
| Chemical Properties | yellow powder | | Uses | suzuki reaction | | Uses | Bis(triphenylphosphine)palladium(II) diacetate can be used as a catalyst for C-C bond formation via Sonogashira coupling, Negishi coupling, Heck coupling, and Suzuki coupling reaction.
It can also be used as a catalyst to synthesize:
- Pyrido[1,2-a]benzimidazole derivatives by electro-oxidative intramolecular C-H/N-H annulation reaction.
- α, β-Unsaturated carboxylic acids by hydroxycarbonylation of vinyl triflates.
- Secondary imides by C-H functionalization of aldehydes with different N-substituted N-heteroarene-2-carboxamides.
|
| | Bis(triphenylphosphinepalladium) acetate Preparation Products And Raw materials |
|