|
| 2-chloro-4-fluoro-3-methylbenzonitrile Basic information |
| 2-chloro-4-fluoro-3-methylbenzonitrile Chemical Properties |
Melting point | 54-58°C | Boiling point | 260.8±35.0 °C(Predicted) | density | 1.28±0.1 g/cm3(Predicted) | storage temp. | Sealed in dry,Room Temperature | solubility | Chloroform (Slightly), Methanol (Slightly) | form | Solid | color | White | InChI | InChI=1S/C8H5ClFN/c1-5-7(10)3-2-6(4-11)8(5)9/h2-3H,1H3 | InChIKey | IOKBJSAKTZEMBR-UHFFFAOYSA-N | SMILES | C(#N)C1=CC=C(F)C(C)=C1Cl |
| 2-chloro-4-fluoro-3-methylbenzonitrile Usage And Synthesis |
Uses | 2-Chloro-4-fluoro-3-methylbenzonitrile is a reagent used in the synthesis of a novel and potent nonsteroidal androgen receptor modulator (SARM) with partial agonist activity relative to the natural androgen testosterone. |
| 2-chloro-4-fluoro-3-methylbenzonitrile Preparation Products And Raw materials |
|