- Mal-PEG4-NHS ester
-
- $0.00 / 1g
-
2024-03-27
- CAS:1325208-25-0
- Min. Order: 1g
- Purity: >98.00%
- Supply Ability: 1g
|
| | Mal-PEG4-NHS ester Basic information |
| Product Name: | Mal-PEG4-NHS ester | | Synonyms: | Mal-PEG4-NHS ester;4,7,10,13-Tetraoxapentadecanoic acid, 15-(2,5-dihydro-2,5-dioxo-1H-pyrrol-1-yl)-, 2,5-dioxo-1-pyrrolidinyl ester;2，5-dioxopyrrolidin-1-yl1-(2，5-dioxo-2H-pyrrol-1(5H)-yl)-3，6，9，12-tetraoxapentadecan-15-oate;MAL-PEG4-Osu;(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]propanoate | | CAS: | 1325208-25-0 | | MF: | C19H26N2O10 | | MW: | 442.42 | | EINECS: | | | Product Categories: | peg | | Mol File: | 1325208-25-0.mol |  |
| | Mal-PEG4-NHS ester Chemical Properties |
| Boiling point | 580.5±60.0 °C(Predicted) | | density | 1.36±0.1 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Soluble in DCM | | pka | -2.34±0.20(Predicted) | | InChI | InChI=1S/C19H26N2O10/c22-15-1-2-16(23)20(15)6-8-28-10-12-30-14-13-29-11-9-27-7-5-19(26)31-21-17(24)3-4-18(21)25/h1-2H,3-14H2 | | InChIKey | TUPOSLKVPPFQGR-UHFFFAOYSA-N | | SMILES | C(ON1C(=O)CCC1=O)(=O)CCOCCOCCOCCOCCN1C(=O)C=CC1=O |
| | Mal-PEG4-NHS ester Usage And Synthesis |
| Description | Mal-PEG4-NHS ester is a PEG linker containing a maleimide group and an NHS ester group. The hydrophilic PEG spacer increases solubility in aqueous media. The NHS ester can be used to label the primary amines (-NH2) of proteins, amine-modified oligonucleotides, and other amine-containing molecules. The maleimide group will react with a thiol group to form a covalent bond, enabling the connection of biomolecule with a thiol. |
| | Mal-PEG4-NHS ester Preparation Products And Raw materials |
|