|
| 7-Aminodesacetoxycephalosporanic acid Basic information |
Product Name: | 7-Aminodesacetoxycephalosporanic acid | Synonyms: | 7-Amino-3-methyl-3-cephem-4-carboxylic acid(7-ADCA);( 7-AMINO DESACETOXY CEPALOSPHORANIC ACID;7-AMINODESACETOXYCEPHALOSPORANIC ACID, 98;7-Phenglacetamido-3-chloromethyl-3-cephem-4-carboxylic acid p-methoxybenzyl ester;7-ADCA 98.5+%;7-ADCA;7-Amino-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid;7-Aminodesacetoxycephalosporanic acid | CAS: | 26395-99-3 | MF: | C8H10N2O3S | MW: | 214.24 | EINECS: | 247-654-5 | Product Categories: | pharmacetical | Mol File: | 26395-99-3.mol | |
| 7-Aminodesacetoxycephalosporanic acid Chemical Properties |
Melting point | >185°C (dec._) | Boiling point | 517.6±50.0 °C(Predicted) | density | 1.59±0.1 g/cm3(Predicted) | storage temp. | -20°C Freezer | solubility | Aqueous Base (Slightly), DMSO (Very Slightly, Heated) | pka | 3.04±0.50(Predicted) | form | Solid | color | White to Pale Beige | InChI | InChI=1S/C8H10N2O3S/c1-3-2-14-7-4(9)6(11)10(7)5(3)8(12)13/h4,7H,2,9H2,1H3,(H,12,13) | InChIKey | NVIAYEIXYQCDAN-UHFFFAOYSA-N | SMILES | N12C(C(N)C1=O)SCC(C)=C2C(O)=O |
Hazard Codes | Xn | Risk Statements | 42/43 | Safety Statements | 36 |
| 7-Aminodesacetoxycephalosporanic acid Usage And Synthesis |
Uses | 7-Aminodesacetoxycephalosporanic Acid (Cefadroxil EP Impurity B) is a metabolite of Cephalexin (C256800). |
| 7-Aminodesacetoxycephalosporanic acid Preparation Products And Raw materials |
|