|
|
| | 3-Chloro-2-fluoroaniline Basic information |
| | 3-Chloro-2-fluoroaniline Chemical Properties |
| Boiling point | 214 °C (lit.) | | density | 1.324 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.564(lit.) | | Fp | 230 °F | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | clear liquid | | pka | 2.15±0.10(Predicted) | | Specific Gravity | 1.34 | | color | Colorless to Brown | | InChI | InChI=1S/C6H5ClFN/c7-4-2-1-3-5(9)6(4)8/h1-3H,9H2 | | InChIKey | XWBTZHDDWRNOQH-UHFFFAOYSA-N | | SMILES | C1(N)=CC=CC(Cl)=C1F | | CAS DataBase Reference | 2106-04-9(CAS DataBase Reference) | | EPA Substance Registry System | 3-Chloro-2-fluoroaniline (2106-04-9) |
| | 3-Chloro-2-fluoroaniline Usage And Synthesis |
| Chemical Properties | clear light beige liquid | | Uses | 3-Chloro-2-fluoroaniline may be used in the preparation of 2-chloro-3-fluorobromobenzene and 4-((3-chloro-2-fluorophenyl)amino)-7-methoxyquinazolin-6-yl acetate. | | General Description | 3-Chloro-2-fluoroaniline is a dihalo-substituted aniline. Its enthalpy of vaporization at boiling point (487.15K) is 42.561kjoule/mol. |
| | 3-Chloro-2-fluoroaniline Preparation Products And Raw materials |
|