imidotriphenylphosphorus manufacturers
|
| | imidotriphenylphosphorus Basic information |
| Product Name: | imidotriphenylphosphorus | | Synonyms: | imidotriphenylphosphorus;Iminotriphenylphosphorane;N-(Triphenylphosphoranylidene)amine;Triphenylphosphine imide;Triphenylphosphinimine;Triphenylphosphine imine;imino-tri(phenyl)-λ5-phosphane;Phosphine imide, P,P,P-triphenyl- | | CAS: | 2240-47-3 | | MF: | C18H16NP | | MW: | 277.3 | | EINECS: | 218-807-3 | | Product Categories: | | | Mol File: | 2240-47-3.mol |  |
| | imidotriphenylphosphorus Chemical Properties |
| Melting point | 236 °C | | Boiling point | 404.7±28.0 °C(Predicted) | | density | 1.09±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | InChI | InChI=1S/C18H16NP/c19-20(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15,19H | | InChIKey | DHOUOTPZYIKUDF-UHFFFAOYSA-N | | SMILES | N=P(C1C=CC=CC=1)(C1C=CC=CC=1)C1C=CC=CC=1 |
| | imidotriphenylphosphorus Usage And Synthesis |
| | imidotriphenylphosphorus Preparation Products And Raw materials |
|