- Cyclopropylacetic acid
-
- $0.00 / 25KG
-
2025-08-08
- CAS:5239-82-7
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 50000KG/month
|
| | Cyclopropylacetic acid Basic information |
| Product Name: | Cyclopropylacetic acid | | Synonyms: | 2-Cyclopropaneacetic acid;2-Cyclopropyl-acetic acid;CYCLOPROPYLACETIC ACID;RARECHEM AL BO 1300;TIMTEC-BB SBB005442;Cyclopropylaceticacid,97%;(Carboxymethyl)cyclopropane;2-cyclopropylethanoic acid | | CAS: | 5239-82-7 | | MF: | C5H8O2 | | MW: | 100.12 | | EINECS: | 000-000-0 | | Product Categories: | | | Mol File: | 5239-82-7.mol |  |
| | Cyclopropylacetic acid Chemical Properties |
| Boiling point | 86-87°C 9mm | | density | 1,076 g/cm3 | | refractive index | 1.4350 | | Fp | 93°C | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | pka | 4.76±0.10(Predicted) | | color | Clear Colourless | | BRN | 2323311 | | InChI | InChI=1S/C5H8O2/c6-5(7)3-4-1-2-4/h4H,1-3H2,(H,6,7) | | InChIKey | KVVDRQDTODKIJD-UHFFFAOYSA-N | | SMILES | C1(CC(O)=O)CC1 | | CAS DataBase Reference | 5239-82-7(CAS DataBase Reference) | | NIST Chemistry Reference | Cyclopropaneacetic acid(5239-82-7) |
| | Cyclopropylacetic acid Usage And Synthesis |
| Chemical Properties | colorless liquid | | Uses | Cyclopropylacetic Acid is used in the synthesis of many organic compounds. Such compounds include Cyproconazole which is an agricultural fungicide and also in synthesis of potent nicotinic acid receptor agonists used in treatment of Dyslipidemia. |
| | Cyclopropylacetic acid Preparation Products And Raw materials |
|