|
|
| | rac-1,2-Ethylenebis(indenyl)zirconium dichloride Chemical Properties |
| Melting point | 66.4 °C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Powder | | color | yellow to orange | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/C20H18.2ClH.Zr/c1-3-7-19-15(5-1)9-11-17(19)13-14-18-12-10-16-6-2-4-8-20(16)18;;;/h1-12,17-18H,13-14H2;2*1H;/q;;;+2/p-2 | | InChIKey | IJSDUKZKUCXMRL-UHFFFAOYSA-L | | SMILES | C12C(C=CC=1C=CC=C2)CCC1C=CC2C=CC=CC1=2.[Zr](Cl)Cl |
| Hazard Codes | C | | Risk Statements | 22-34-40 | | Safety Statements | 26-36/37/39-45 | | RIDADR | 1759 | | WGK Germany | 1 | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29319090 |
| | rac-1,2-Ethylenebis(indenyl)zirconium dichloride Usage And Synthesis |
| Storage Stability | When stored under suitable conditions in unopened original package, shelf life is one year. | | Chemical Properties | orange powder | | Uses | rac-1,2-Ethylenebis(indenyl)zirconium dichloride is Catalyst component for olefin polymerization, and Useful for the preparation of metallocene type catalysts. | | reaction suitability | core: zirconium reagent type: catalyst |
| | rac-1,2-Ethylenebis(indenyl)zirconium dichloride Preparation Products And Raw materials |
|