|
|
| | N-Boc-piperazine-2-carboxylic acid methyl ester Basic information |
| Product Name: | N-Boc-piperazine-2-carboxylic acid methyl ester | | Synonyms: | METHYL 1-BOC-PIPERAZINE-2-CARBOXYLATE;N-Boc-piperazine-2-carboxylic acid methyl ester;1-Boc-2-Piperazinecarboxylic acid methyl ester;1-Boc-piperazine-2-carboxylic acid methyl ester;Piperazine-1,2-dicarb;Methyl 1-Boc-2-piperazinecarboxylate;1,2-Piperazinedicarboxylic acid, 1-(1,1-diMethylethyl) 2-Methyl ester;1-N-BOC-piperazine-2-carboxylic acid Methyl ester-HCl | | CAS: | 129799-15-1 | | MF: | C11H20N2O4 | | MW: | 244.29 | | EINECS: | | | Product Categories: | Piperaizine | | Mol File: | 129799-15-1.mol |  |
| | N-Boc-piperazine-2-carboxylic acid methyl ester Chemical Properties |
| Boiling point | 321.3±37.0 °C(Predicted) | | density | 1.118g/ml | | storage temp. | 2-8°C(protect from light) | | form | gel/ oil | | pka | 7.25±0.40(Predicted) | | color | Yellow | | Optical Rotation | -2.9800° (C=0.50 g/100ml, MEOH, 20°C, 589nm) | | InChI | InChI=1S/C11H20N2O4/c1-11(2,3)17-10(15)13-6-5-12-7-8(13)9(14)16-4/h8,12H,5-7H2,1-4H3 | | InChIKey | BRXKHIPPSTYCKO-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCNCC1C(OC)=O | | CAS DataBase Reference | 129799-15-1(CAS DataBase Reference) |
| | N-Boc-piperazine-2-carboxylic acid methyl ester Usage And Synthesis |
| Uses | 1-tert-Butyl 2-methyl piperazine-1,2-dicarboxylate is a useful research chemical compound used in the preparation of piperazinylcarbonylaminomethylcarbonylpiperidines as melanocortin-4 receptor agonists. | | Synthesis | The general procedure for the synthesis of methyl N-1-Boc-2-piperazinecarboxylate from 4-benzyl 1-tert-butyl 2-methylpiperazine-1,2,4-tricarboxylate is as follows:
Example 53 - Preparation of Intermediate 18: The synthesis of Intermediate 18 followed General Procedure 14. To a solution of Intermediate 17 (1-benzyl stirred solution of 4-benzyl 1-methylpiperazine-1,2,4-tricarboxylic acid, 10 g, 26.5 mmol) in MeOH (100 mL) was added 10% Pd/C (30% w/w, 3.0 g). The mixture was placed in a steel vessel and stirred at room temperature under 50 psi hydrogen pressure for 5 hours. Upon completion of the reaction, the reaction mixture was filtered through a diatomaceous earth pad and the volatiles were concentrated under reduced pressure to afford 1-tert-butyl 2-methylpiperazine-1,2-dicarboxylate (Intermediate 18, 5.6 g, Yield: 88%) as a light yellow liquid.TLC conditions: 5% methanol-dichloromethane, Rf=0.3. | | References | [1] Patent: WO2016/138532, 2016, A1. Location in patent: Paragraph 0288
[2] Patent: US2010/160323, 2010, A1. Location in patent: Page/Page column 47
[3] Patent: US4997836, 1991, A
[4] Patent: EP368670, 1990, A1
[5] Patent: US2004/116518, 2004, A1. Location in patent: Page 42 |
| | N-Boc-piperazine-2-carboxylic acid methyl ester Preparation Products And Raw materials |
|