|
|
| | (5-tert-butyl-isoxazol-3-yl)-carbaMic acid phenyl ester, (5-tert-butylisoxazol-3-yl)carbaMic acid phenyl ester Basic information |
| | (5-tert-butyl-isoxazol-3-yl)-carbaMic acid phenyl ester, (5-tert-butylisoxazol-3-yl)carbaMic acid phenyl ester Chemical Properties |
| Boiling point | 362.9±34.0 °C(Predicted) | | density | 1.198±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 11.38±0.70(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C14H16N2O3/c1-14(2,3)11-9-12(16-19-11)15-13(17)18-10-7-5-4-6-8-10/h4-9H,1-3H3,(H,15,16,17) | | InChIKey | FGUDMROYDQCCNY-UHFFFAOYSA-N | | SMILES | C(OC1=CC=CC=C1)(=O)NC1C=C(C(C)(C)C)ON=1 |
| | (5-tert-butyl-isoxazol-3-yl)-carbaMic acid phenyl ester, (5-tert-butylisoxazol-3-yl)carbaMic acid phenyl ester Usage And Synthesis |
| | (5-tert-butyl-isoxazol-3-yl)-carbaMic acid phenyl ester, (5-tert-butylisoxazol-3-yl)carbaMic acid phenyl ester Preparation Products And Raw materials |
|