| Company Name: |
Mainchem Co., Ltd.
|
| Tel: |
+86-0592-6210733 |
| Email: |
sale@mainchem.com |
| Products Intro: |
Product Name:3-CARBAMOYL-2,2,5,5-TETRAMETHYL-3-PYRROLIN-1-YLOXY
CAS:3229-73-0
|
3-CARBAMOYL-2,2,5,5-TETRAMETHYL-3-PYRROLIN-1-YLOXY manufacturers
|
| | 3-CARBAMOYL-2,2,5,5-TETRAMETHYL-3-PYRROLIN-1-YLOXY Basic information |
| Product Name: | 3-CARBAMOYL-2,2,5,5-TETRAMETHYL-3-PYRROLIN-1-YLOXY | | Synonyms: | CARBAMOYL-2,2,5,5-TETRAMETHYL-3-PYRROLIN-1-YLOXY;3-CARBAMOYL-2,2,5,5-TETRAMETHYL-3- PYRROLIN-1-YLOXY FREE RADICAL 99%;2,2,5,5-Tetramethyl-3-carbamido-3-pyrroline-1-oxyl, 3-Carbamoyl-2,5-dihydro-2,2,5,5-tetramethyl-1H-pyrrol-1-yloxy;3-Carbamoyl-2,2,5,5-tetramethyl-3-pyrrolin-1-yloxy, 99%, free radical;Carbamoyl-2,2,5,5-tetramethyl-3-pyrrolin-1-yloxy, free radical, 99%-2,2,5,5--3-;3-(Aminocarbonyl)-2,5-dihydro-2,2,5,5-tetramethyl-1H-pyrrol-1-yloxy;3-Carbamoyl-2,2,5,5-tetramethylpyrroline-1-oxyl;CARPYR | | CAS: | 3229-73-0 | | MF: | C9H15N2O2* | | MW: | 183.23 | | EINECS: | 221-765-9 | | Product Categories: | Spin Labeling Compounds | | Mol File: | 3229-73-0.mol |  |
| | 3-CARBAMOYL-2,2,5,5-TETRAMETHYL-3-PYRROLIN-1-YLOXY Chemical Properties |
| Melting point | 197-200 °C(lit.) | | Boiling point | 316.91°C (rough estimate) | | density | 1.1277 (rough estimate) | | refractive index | 1.4922 (estimate) | | storage temp. | 2-8°C | | solubility | Soluble in acetone, chloroform, dichloromethane, ethyl acetate and methanol. | | form | Solid | | color | Light Brown | | BRN | 4138020 | | InChI | 1S/C9H15N2O2/c1-8(2)5-6(7(10)12)9(3,4)11(8)13/h5H,1-4H3,(H2,10,12) | | InChIKey | RUEXQFPLRRIFTI-UHFFFAOYSA-N | | SMILES | CC1(C)C=C(C(N)=O)C(C)(C)N1[O] | | CAS DataBase Reference | 3229-73-0(CAS DataBase Reference) | | EPA Substance Registry System | 1H-Pyrrol-1-yloxy, 3-(aminocarbonyl)-2,5-dihydro-2,2,5,5-tetramethyl- (3229-73-0) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29339980 | | Storage Class | 11 - Combustible Solids |
| | 3-CARBAMOYL-2,2,5,5-TETRAMETHYL-3-PYRROLIN-1-YLOXY Usage And Synthesis |
| Chemical Properties | Yellow Crystalline Solid | | Uses | 3-Carbamoyl-2,2,5,5-tetramethyl-3-pyrrolin-1-oxyl is a nitroxide radical that can be used:
- As a spin probe in the study of simulation of Overhauser?dynamic nuclear polarization signal.
- As a starting material in the synthesis of nitroxide based polyethers possessing charge transport properties.
- As a nitroxide imaging probe applicable for EPR imaging of brain diseases in animal models.
| | Uses | It is employed as a highly reactive spin-label. |
| | 3-CARBAMOYL-2,2,5,5-TETRAMETHYL-3-PYRROLIN-1-YLOXY Preparation Products And Raw materials |
|