|
| 2'-Deoxyadenosine-5'-monophosphate disodium salt Basic information |
Product Name: | 2'-Deoxyadenosine-5'-monophosphate disodium salt | Synonyms: | 2''-DEOXYADENOSINE-5''-MONOPHOSPHATE DISODIUM SALT (DAMP);2-DEOXYADENOSINE-5-MONOPHOSPHATE DISODIUM SALT extrapure;2'-Deoxyadenosine 5'-phosphoric acid disodium salt;[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate;[(2R,3S,5R)-5-(6-aminopurin-9-yl)-3-hydroxy-tetrahydrofuran-2-yl]methyl dihydrogen phosphate;[(2R,3S,5R)-5-(6-azanylpurin-9-yl)-3-hydroxy-oxolan-2-yl]methyl dihydrogen phosphate;2’-Deoxyadenosine-5’-monophosphate disodium sa;2'-DEOXYADENYLIC ACID SODIUM SALT | CAS: | 2922-74-9 | MF: | C10H15N5NaO6P | MW: | 355.22 | EINECS: | 220-873-3 | Product Categories: | Pharmaceutical | Mol File: | 2922-74-9.mol | |
| 2'-Deoxyadenosine-5'-monophosphate disodium salt Chemical Properties |
storage temp. | Inert atmosphere,Store in freezer, under -20°C | solubility | H2O: 50 mg/mL, clear, colorless | InChI | InChI=1/C10H14N5O6P.Na.H/c11-9-8-10(13-3-12-9)15(4-14-8)7-1-5(16)6(21-7)2-20-22(17,18)19;;/h3-7,16H,1-2H2,(H2,11,12,13)(H2,17,18,19);;/t5-,6+,7+;;/s3 | InChIKey | VLJHDKARANSOJK-BPETZYGMNA-N | SMILES | NC1=NC=NC2N([C@H]3C[C@H](O)[C@@H](COP(O)(O)=O)O3)C=NC1=2.[NaH] |&1:7,9,11,r| | CAS DataBase Reference | 2922-74-9(CAS DataBase Reference) |
| 2'-Deoxyadenosine-5'-monophosphate disodium salt Usage And Synthesis |
Description | 2'-Deoxyadenosine-5'-monophosphate disodium salt is a nucleic acid AMP derivative found in DNA. 2?-Deoxyadenosine 5?-monophosphate disodium can be used to study adenosine-based interactions during DNA synthesis and DNA damage. 2'-Deoxyadenosine-5'-monophosphate disodium salt reacts with chloride ions to form 2',3'-diacetylpyridine-5'-diphosphate dibasic chloride, which has been shown to inhibit bacterial growth and act as an antibacterial agent. |
| 2'-Deoxyadenosine-5'-monophosphate disodium salt Preparation Products And Raw materials |
|