|
|
| | 1,3-BIS(BENZYLOXY)-2-PROPANOL Basic information |
| | 1,3-BIS(BENZYLOXY)-2-PROPANOL Chemical Properties |
| Boiling point | 226-227 °C3 mm Hg(lit.) | | density | 1.103 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.549(lit.) | | Fp | >230 °F | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 13.62±0.20(Predicted) | | form | Oil | | color | Clear Colourless to Pale Yellow | | BRN | 1986774 | | InChI | InChI=1S/C17H20O3/c18-17(13-19-11-15-7-3-1-4-8-15)14-20-12-16-9-5-2-6-10-16/h1-10,17-18H,11-14H2 | | InChIKey | ARLSYSVVBAMYKA-UHFFFAOYSA-N | | SMILES | C(OCC1=CC=CC=C1)C(O)COCC1=CC=CC=C1 | | CAS DataBase Reference | 6972-79-8(CAS DataBase Reference) | | EPA Substance Registry System | 2-Propanol, 1,3-bis(phenylmethoxy)- (6972-79-8) |
| Safety Statements | 23-24/25 | | WGK Germany | 3 | | HS Code | 2909498090 |
| | 1,3-BIS(BENZYLOXY)-2-PROPANOL Usage And Synthesis |
| Chemical Properties | Pale-Yellow Oil | | Uses | 1,3-Dibenzyloxy-2-propanol was used in the synthesis of 1,3-dibenzyloxyacetone. It was also used as precursor to antiviral intermediates. | | Uses | Having spasmolytic and cholinolytic activity |
| | 1,3-BIS(BENZYLOXY)-2-PROPANOL Preparation Products And Raw materials |
|