- EDTA-3K
-
- $0.00 / 1kg
-
2025-06-20
- CAS:17572-97-3
- Min. Order: 1kg
- Purity: 50.00%
- Supply Ability: 20tons
|
| | Tripotassium hydrogen ethylenediaminetetraacetate Basic information |
| Product Name: | Tripotassium hydrogen ethylenediaminetetraacetate | | Synonyms: | ETHYLENEDIAMINETETRAACETIC ACID TRIPOTASSIUM SALT;ETHYLENEBIS(IMINODIACETIC ACID) TRIPOTASSIUM SALT;ethylenediamine-n,n,n',n'-tetraacetic acid tripotassium salt;ETHYLENEDIAMINE TETRAACETIC ACID K3-SALT;(ethylenedinitrilo)tetra-aceticacitripotassiumsalt;Glycine,N,N’-1,2-ethanediylbis[N-(carboxymethyl)-,tripotassiumsalt;n,n’-1,2-ethanediylbis(n-(carboxymethyl)glycine),tripotassiumsalt;n,n’-1,2-ethanediylbis(n-(carboxymethyl)-glycintripotassiumsalt | | CAS: | 17572-97-3 | | MF: | C10H17KN2O8 | | MW: | 332.35 | | EINECS: | 241-543-5 | | Product Categories: | | | Mol File: | 17572-97-3.mol |  |
| | Tripotassium hydrogen ethylenediaminetetraacetate Chemical Properties |
| Melting point | >300 C | | density | 1.8[at 20℃] | | vapor pressure | 0Pa at 25℃ | | storage temp. | Sealed in dry,Room Temperature | | form | Crystalline | | Appearance | White to off-white Solid | | Water Solubility | Soluble | | Cosmetics Ingredients Functions | CHELATING | | InChI | InChI=1S/C10H16N2O8.K.H/c13-7(14)3-11(4-8(15)16)1-2-12(5-9(17)18)6-10(19)20;;/h1-6H2,(H,13,14)(H,15,16)(H,17,18)(H,19,20);; | | InChIKey | UCWFIIRKRSXKQO-UHFFFAOYSA-N | | SMILES | N(CC(=O)O)(CC(=O)O)CCN(CC(=O)O)CC(=O)O.[KH] | | LogP | -4.3 at 25℃ | | CAS DataBase Reference | 17572-97-3(CAS DataBase Reference) | | EPA Substance Registry System | Ethylenediaminetetraacetic acid tripotassium salt (17572-97-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36/37 | | TSCA | TSCA listed | | HS Code | 29224985 |
| Provider | Language |
|
ALFA
| English |
| | Tripotassium hydrogen ethylenediaminetetraacetate Usage And Synthesis |
| Uses | Ethylenediaminetetraacetic acid tripotassium salt is used to eliminate enzyme inhibition by traces of heavy metals, and to inhibit enzymes that require divalent cations as cofactors. And it is also used to study chelators, biochemicals and reagents. EDTA tripotassium salt has been used in a study to assess the safety of EDTA and HEDTA ingredients in cosmetic formulations. | | Flammability and Explosibility | Non flammable |
| | Tripotassium hydrogen ethylenediaminetetraacetate Preparation Products And Raw materials |
|