|
|
| | 2-ethylhexyl laurate Basic information |
| Product Name: | 2-ethylhexyl laurate | | Synonyms: | 2-ethylhexyl laurate;ETHYLHEXYL LAURATE;Dodecanoic acid, 2-ethylhexyl ester;2-Ethylhexyllaurat;Lauric acid 2-ethylhexyl ester;Einecs 243-697-9;LP009844 2-ETHYLHEXYL DODECANOATE;2-octyl laurate | | CAS: | 20292-08-4 | | MF: | C20H40O2 | | MW: | 312.53 | | EINECS: | 243-697-9 | | Product Categories: | | | Mol File: | 20292-08-4.mol |  |
| | 2-ethylhexyl laurate Chemical Properties |
| Boiling point | 303 °C | | density | 0.854 g/cm3 | | Water Solubility | 1.44μg/L at 25℃ | | InChI | InChI=1S/C20H40O2/c1-4-7-9-10-11-12-13-14-15-17-20(21)22-18-19(6-3)16-8-5-2/h19H,4-18H2,1-3H3 | | InChIKey | LWLRMRFJCCMNML-UHFFFAOYSA-N | | SMILES | C(OCC(CC)CCCC)(=O)CCCCCCCCCCC | | LogP | 8.030 | | EPA Substance Registry System | 2-Ethylhexyl laurate (20292-08-4) |
| | 2-ethylhexyl laurate Usage And Synthesis |
| Flammability and Explosibility | Non flammable |
| | 2-ethylhexyl laurate Preparation Products And Raw materials |
|