|
| 2,6-Pyridinedicarboxylic acid chloride Basic information |
Product Name: | 2,6-Pyridinedicarboxylic acid chloride | Synonyms: | PYRIDINE-2,6-DICARBONYL CHLORIDE;PYRIDINE-2,6-DICARBOXYLIC ACID CHLORIDE;2,6-PYRIDINEDICARBOXYLIC ACID CHLORIDE;(S)-(-)-1-(4-METHOXYPHENYL)ETHANOL;2,6-Pyridinedicarbonyl chloride, Pyridine-2,6-dicarboxylic acid chloride;2,6-Bis(chlorocarbonyl)pyridine;2,6-Pyridinedicarbonyl dichloride ,97%;2,6-Pyridinebis(carbonyl chloride) | CAS: | 3739-94-4 | MF: | C7H3Cl2NO2 | MW: | 204.01 | EINECS: | 223-125-4 | Product Categories: | | Mol File: | 3739-94-4.mol | ![2,6-Pyridinedicarboxylic acid chloride Structure](CAS/GIF/3739-94-4.gif) |
| 2,6-Pyridinedicarboxylic acid chloride Chemical Properties |
Melting point | 56-58 °C (lit.) | Boiling point | 284 °C (lit.) | density | 1.4521 (rough estimate) | refractive index | 1.6100 (estimate) | Fp | 284°C | pka | -2.12±0.10(Predicted) | form | Crystalline Powder, Crystals or Chunks | color | White to brown | Water Solubility | Insoluble in water. | Sensitive | Moisture Sensitive | BRN | 131556 | InChI | InChI=1S/C7H3Cl2NO2/c8-6(11)4-2-1-3-5(10-4)7(9)12/h1-3H | InChIKey | GWHOGODUVLQCEB-UHFFFAOYSA-N | SMILES | C1(C(Cl)=O)=NC(C(Cl)=O)=CC=C1 | CAS DataBase Reference | 3739-94-4(CAS DataBase Reference) | NIST Chemistry Reference | 2,6-Pyridinedicarbony chloride(3739-94-4) |
Hazard Codes | C | Risk Statements | 34 | Safety Statements | 26-36/37/39-45-24/25 | RIDADR | UN 3261 8/PG 2 | WGK Germany | 3 | F | 10-19-21 | HazardClass | 8 | PackingGroup | II | HS Code | 29333990 |
| 2,6-Pyridinedicarboxylic acid chloride Usage And Synthesis |
Chemical Properties | white to brown crystalline powder, crystals or | Uses | 2,6-Pyridinedicarbonyl dichloride can be used as a starting material to synthesize:
- Pyridine-based polyamido-polyester optically active macrocycles by reacting with chiral diamine dihydrobromides.
- Pyridine-bridged 2,6-bis-carboxamide Schiff′s bases by treating with L-alanine or 2-methyl-alanine methyl esters.
- N,N′-bis(1-pyrenylmethyl)pyridine-2,6-dicarboxamide by reacting with 1-pyrenemethylamine hydrochloride in the presence of a base.
| Uses | 2,6-Pyridinedicarboxylic acid chloride was used as the reagent during the synthesis of pyridine-based polyamido-polyester optically active macrocycles. It was used as starting reagent during the synthesis of pyridine-bridged 2,6-bis-carboxamide Schiff′s bases. It was used in the synthesis of N,N′-bis(1-pyrenylmethyl)pyridine-2,6-dicarboxamide. | Synthesis | Pyridine-2,6-dicarboxylic acid (105 mg, 0.52 mmol) mixed with 7mL of thionyl
chloride was heated to reflux for 3 hours. After the excess thionyl chloride was
removed, a white solid was obtained and used for the following synthesis without
further purifications.
![Synthesis_3739-94-4](/NewsImg/2022-09-09/6379833477778143143263022.jpg) |
| 2,6-Pyridinedicarboxylic acid chloride Preparation Products And Raw materials |
|