|
|
| | L-tert-leucinaMide hydrochloride Basic information |
| Product Name: | L-tert-leucinaMide hydrochloride | | Synonyms: | L-tert-leucinaMide hydrochloride;L-tert-Leucine aMide HCl (Tle-NH2.HCl);L-Tert-Leucinamide HCl;H-Tle-NH2.HCl(L-tertleucinaMide);(2S)-2-Amino-3,3-dimethylbutanamide hydrochloride;L-Tert-leucine amide HCl;L-tert-leucinaMide hydrochloride, CP;L-TERT-LEUCINAMIDE HYDROCHLORIDE(CAS NO.75158-12-2) | | CAS: | 75158-12-2 | | MF: | C6H15ClN2O | | MW: | 166.65 | | EINECS: | | | Product Categories: | 75158-12-2 | | Mol File: | 75158-12-2.mol |  |
| | L-tert-leucinaMide hydrochloride Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | InChI | InChI=1/C6H14N2O.ClH/c1-6(2,3)4(7)5(8)9;/h4H,7H2,1-3H3,(H2,8,9);1H/t4-;/s3 | | InChIKey | ZTHDYUDIZSIFRY-NDILARRWNA-N | | SMILES | [C@@H](N)(C(=O)N)C(C)(C)C.Cl |&1:0,r| |
| | L-tert-leucinaMide hydrochloride Usage And Synthesis |
| | L-tert-leucinaMide hydrochloride Preparation Products And Raw materials |
|