|
| tert-Butyl 2-bromo-2-methylpropanoate Basic information |
Product Name: | tert-Butyl 2-bromo-2-methylpropanoate | Synonyms: | 2-BOC-2-BROMOPROPANE;2-BROMO-2-METHYL-PROPIONIC ACID TERT-BUTYL ESTER;2-BROMOISOBUTYRIC ACID TERT-BUTYL ESTER;butyl2-bromoisobutyrate;tert-Butyl alpha-broMoisobutyrate >=98.0%;2-broMotert butylisobutyrate;Propanoicacid,2-bromo-2-methyl-,1,1-dimethylethylester;tert-Buty2-bromoisobutyrate | CAS: | 23877-12-5 | MF: | C8H15BrO2 | MW: | 223.11 | EINECS: | 245-924-7 | Product Categories: | Organic acids | Mol File: | 23877-12-5.mol | ![tert-Butyl 2-bromo-2-methylpropanoate Structure](CAS/GIF/23877-12-5.gif) |
| tert-Butyl 2-bromo-2-methylpropanoate Chemical Properties |
Boiling point | 35-37°C 1mm | density | 1.196 g/mL at 20 °C(lit.) | refractive index | n20/D 1.436 | Fp | 35-37°C/1mm | storage temp. | Inert atmosphere,Room Temperature | solubility | Chloroform | form | Oil | color | Clear Colorless | Specific Gravity | 1.196 | BRN | 1905654 | InChI | InChI=1S/C8H15BrO2/c1-7(2,3)11-6(10)8(4,5)9/h1-5H3 | InChIKey | IGVNJALYNQVQIT-UHFFFAOYSA-N | SMILES | C(OC(C)(C)C)(=O)C(Br)(C)C | CAS DataBase Reference | 23877-12-5(CAS DataBase Reference) |
| tert-Butyl 2-bromo-2-methylpropanoate Usage And Synthesis |
Chemical Properties | Colorless liquid | Uses | tert-Butyl α-bromoisobutyrate was used as an initiator in the atom transfer radical polymerisation (ATRP) of 2-(acetoacetoxy)ethyl methacrylate (AEMA). |
| tert-Butyl 2-bromo-2-methylpropanoate Preparation Products And Raw materials |
|