|
|
| | 1α-(Chloromethyl) Chlormadinone Acetate Basic information |
| Product Name: | 1α-(Chloromethyl) Chlormadinone Acetate | | Synonyms: | 6-Chloro-1alpha-(chloromethyl)-17-hydroxypregna-4,6-diene-3,20-dione acetate;6-chioro-1α-chloromethyl-3,20-dioxo-pregna-4,6-dien-17α-acetoxy;Pregna-4,6-diene-3,20-dione, 17-(acetyloxy)-6-chloro-1-(chloromethyl)-, (1a)-;(1alpha)-17-(Acetyloxy)-6-chloro-1-(chloroMethyl)prehna-4,6-diene-3,20-dione;Color Pronk chloride;1-ChlormehylL-6-Chloro-6-Dehydro-
17α-Acetoxy-Progesterone;Cyproterone Intermediates 2;1-CHLOROMETHYL-6-CHLORO-6-DEHYDRO-17ACETOXY PROGESTRONE | | CAS: | 17183-98-1 | | MF: | C24H30Cl2O4 | | MW: | 453.4 | | EINECS: | 605-617-4 | | Product Categories: | Impurities;Intermediates & Fine Chemicals;Pharmaceuticals;Steroids | | Mol File: | 17183-98-1.mol |  |
| | 1α-(Chloromethyl) Chlormadinone Acetate Chemical Properties |
| Melting point | >198°C (dec.) | | Boiling point | 554.4±50.0 °C(Predicted) | | density | 1.27 | | vapor pressure | 0-0Pa at 20-30℃ | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), DMSO (Slightly, Heated), Methanol (Slightly) | | form | Solid | | color | Off-White to Light Yellow | | InChIKey | MFEGXCLQSLHLPH-UKSBCAJDNA-N | | SMILES | [C@@]1([C@@]2(C)CC[C@]3([H])[C@@]4(C)[C@@H](CCl)CC(=O)C=C4C(Cl)=C[C@@]3([H])[C@]2([H])CC1)(C(=O)C)OC(=O)C |&1:0,1,5,7,9,20,22,r| | | LogP | 3.52 at 25℃ and pH7 |
| | 1α-(Chloromethyl) Chlormadinone Acetate Usage And Synthesis |
| Uses | 1α-(Chloromethyl) Chlormadinone Acetate (Cyproterone Acetate EP Impurity C) is an impurity of Cyproterone acetate (C989100), as antiandrogenic steroid. |
| | 1α-(Chloromethyl) Chlormadinone Acetate Preparation Products And Raw materials |
|