|
|
| | 2-Hydroxyphenylacetic acid Basic information |
| | 2-Hydroxyphenylacetic acid Chemical Properties |
| Melting point | 145-147 °C (lit.) | | Boiling point | 240°C (estimate) | | density | 1.2143 (rough estimate) | | refractive index | 1.4945 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Methanol, Water | | form | Crystalline Powder | | pka | 4.17±0.10(Predicted) | | color | Light pink to light brown | | Water Solubility | Soluble in Methanol and Water. | | BRN | 908000 | | InChI | InChI=1S/C8H8O3/c9-7-4-2-1-3-6(7)5-8(10)11/h1-4,9H,5H2,(H,10,11) | | InChIKey | CCVYRRGZDBSHFU-UHFFFAOYSA-N | | SMILES | C1(CC(O)=O)=CC=CC=C1O | | CAS DataBase Reference | 614-75-5(CAS DataBase Reference) | | NIST Chemistry Reference | Benzeneacetic acid, 2-hydroxy-(614-75-5) | | EPA Substance Registry System | 2-Hydroxyphenylacetic acid (614-75-5) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 10-23 | | Hazard Note | Irritant | | TSCA | Yes | | HS Code | 29182990 |
| | 2-Hydroxyphenylacetic acid Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | 2-Hydroxyphenylacetic Acid is an intermediate in the synthesis of atenolol and 3,4-dihydroxyphenylacetic acid. | | Definition | ChEBI: A hydroxy monocarboxylic acid that is acetic acid in which one of the methyl hydrogens is substituted by a 2-hydroxyphenyl group. It is a metabolite of phenylalanine and is excreted in the urine of patients suffering from diseases like phenylketonuria. | | Purification Methods | Crystallise the acid from ether or chloroform (m 147o, m from latter solvent is always lower). [Beilstein 10 H 187, 10 I 81, 10 II 112, 10 III 422, 10 IV 536.] |
| | 2-Hydroxyphenylacetic acid Preparation Products And Raw materials |
|