|
|
| | Tetrafluorophthalic anhydride Basic information |
| Product Name: | Tetrafluorophthalic anhydride | | Synonyms: | Tetrafluorophathlic Anhydride;3,4,5,6-TETRAFLUOROPHTHALIC ANHYDRIDE;TETRAFLUOROPHTHALIC ANHYDRIDE;3,4,5,6-Tetrafluorophthalic anhydride 98%;3,4,5,6-Tetrafluorophthalicanhydride98%;4,5,6,7-Tetrafluoro-1,3-dihydroisobenzofuran-1,3-dione;4,5,6,7-Tetrafluoro-1,3-isobenzofurandione;Tetrafluoroisobenzofuran-1,3-dione | | CAS: | 652-12-0 | | MF: | C8F4O3 | | MW: | 220.08 | | EINECS: | 211-485-5 | | Product Categories: | Monomers;Polymer Science;Anhydride Monomers;Fluorobenzene;Highly Purified Reagents;Other Categories;Refined Products by Sublimation;Phthalic Acids, Esters and Derivatives | | Mol File: | 652-12-0.mol |  |
| | Tetrafluorophthalic anhydride Chemical Properties |
| Melting point | 94-96 °C(lit.) | | Boiling point | 332.6±42.0 °C(Predicted) | | density | 1.843±0.06 g/cm3(Predicted) | | solubility | Soluble in most organic solvents and acetic acid. | | form | Powder | | color | Light grayish to beige | | Sensitive | Moisture Sensitive | | InChI | InChI=1S/C8F4O3/c9-3-1-2(8(14)15-7(1)13)4(10)6(12)5(3)11 | | InChIKey | BJDDKZDZTHIIJB-UHFFFAOYSA-N | | SMILES | C1(=O)C2=C(C(F)=C(F)C(F)=C2F)C(=O)O1 | | CAS DataBase Reference | 652-12-0(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 37/39-26-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | IRRITANT, MOISTURE SENSITIVE | | HS Code | 29173990 |
| | Tetrafluorophthalic anhydride Usage And Synthesis |
| Chemical Properties | Light greyish to beige powder |
| | Tetrafluorophthalic anhydride Preparation Products And Raw materials |
|