| Company Name: |
jiliang chemicals
|
| Tel: |
21-62165282 15801962796; |
| Email: |
bidingchem@163.com |
| Products Intro: |
Product Name:4-PHENYL-2-BUTYL ACETATE
CAS:10415-88-0
Purity:98% Package:1kg,5kg
|
| Company Name: |
BOC Sciences
|
| Tel: |
1-631-485-4226; 16314854226 |
| Email: |
info@bocsci.com |
| Products Intro: |
Product Name:4-phenyl-2-butyl acetate
CAS:10415-88-0
|
| Company Name: |
Shaanxi Dideu Newmaterial Co., Ltd.
|
| Tel: |
029-87576359 15353716720 |
| Email: |
1039@dideu.com |
| Products Intro: |
Product Name:4-phenyl-2-butyl acetate
CAS:10415-88-0
Purity:98% Package:25kg
|
|
| | 4-PHENYL-2-BUTYL ACETATE Basic information |
| Product Name: | 4-PHENYL-2-BUTYL ACETATE | | Synonyms: | 2-Butanol, 4-phenyl-, acetate;alpha-methyl-benzenepropanoacetate;Benzenepropanol, alpha-methyl-, acetate;Benzenepropanol,.alpha.-methyl-,acetate;CH3C(O)OCH(CH3)CH2CH2C6H5;Phenylpropanol, alpha-methyl, acetate;1-METHYL-3-PHENYLPROPYL ACETATE;4-PHENYL-2-BUTYL ACETATE | | CAS: | 10415-88-0 | | MF: | C12H16O2 | | MW: | 192.25 | | EINECS: | 233-890-6 | | Product Categories: | | | Mol File: | 10415-88-0.mol |  |
| | 4-PHENYL-2-BUTYL ACETATE Chemical Properties |
| Provider | Language |
|
ACROS
| English |
| | 4-PHENYL-2-BUTYL ACETATE Usage And Synthesis |
| Chemical Properties | 4-Phenyl-2-butyl acetate has a mild, green, fruity odor and a sweet, fruity taste. | | Definition | ChEBI: 4-Phenyl-2-butyl acetate is a member of benzenes. | | Preparation | By acetylation of the corresponding alcohol; the racemic and the dextrorotatory forms are known. |
| | 4-PHENYL-2-BUTYL ACETATE Preparation Products And Raw materials |
|