|
|
| | 3-Amino-4-hydroxybenzoic acid Basic information |
| | 3-Amino-4-hydroxybenzoic acid Chemical Properties |
| Melting point | 208 °C (dec.) (lit.) | | Boiling point | 276.03°C (rough estimate) | | density | 1.3585 (rough estimate) | | refractive index | 1.5500 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | Soluble in solvents. | | pka | 9.06±0.18(Predicted) | | form | Crystalline Powder | | color | Beige-gray to brown | | Sensitive | Light Sensitive | | λmax | 308nm(H2O (pH 11))(lit.) | | BRN | 972238 | | InChI | InChI=1S/C7H7NO3/c8-5-3-4(7(10)11)1-2-6(5)9/h1-3,9H,8H2,(H,10,11) | | InChIKey | MRBKRZAPGUCWOS-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=C(O)C(N)=C1 | | CAS DataBase Reference | 1571-72-8(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | IRRITANT, AIR SENSITIVE, LIGHT SENSITIVE | | HS Code | 29225090 |
| | 3-Amino-4-hydroxybenzoic acid Usage And Synthesis |
| Chemical Properties | beige-grey to brown crystalline powder | | Application | 3-Amino-4-hydroxybenzoic acid is the first matrix to be used specifically for carbohydrates. The other most commonly used matrices are α-cyano-4-hydroxycinnamic acid, 2,5-dihydroxybenzoic acid, and sinapinic acid. Matrix and sample solutions are mixed prior to laser exposure, spotted on a solid metallic surface, and allowed to dry before submitting them to MALDI. These matrices are characterized by high absorptivity of the laser radiation and the capability of forming fine crystalline solids during sample/matrix drying. In general, the more fine-grained and homogeneous the morphology of crystals formed with the analyte/matrix mixture, the more intense the MALDI mass spectrum of the analyte. 3-Amino-4-hydroxybenzoic acid produced [M+Na]+ ions from as little as 1 pmol of dextran hydrolysate and N-linked glycans released from glycoproteins. | | Uses | 3-Amino-4-hydroxybenzoic acid is used to produce 4-acetoxy-3-acetylamino-benzoic acid with acetic acid anhydride at temperature of 0 - 20°C. This reaction will need reagents aq. HCl and NaOAc. | | Definition | ChEBI: A monohydroxybenzoic acid that is 4-hydroxybenzoic acid carrying an additional amino substitutent at position 3. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 54, p. 3740, 1989 DOI: 10.1021/jo00276a044 |
| | 3-Amino-4-hydroxybenzoic acid Preparation Products And Raw materials |
|